About 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine
5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine (PubChem CID 155243022) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine.
Molecular Properties
| Compound Name | 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine |
| PubChem CID | 155243022 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine |
| SMILES | C=CCCC1=C(C)N=C(C)NC1=C |
| InChI | InChI=1S/C11H16N2/c1-5-6-7-11-8(2)12-10(4)13-9(11)3/h5H,1-2,6-7H2,3-4H3,(H,12,13) |
| InChIKey | DGTVQBJTIDKOAC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine?
The IUPAC name of 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine (CID 155243022) is 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine.
What is the SMILES notation for 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine?
The canonical SMILES for 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine is C=CCCC1=C(C)N=C(C)NC1=C.
What is the InChIKey of 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine?
The InChIKey is DGTVQBJTIDKOAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-5-6-7-11-8(2)12-10(4)13-9(11)3/h5H,1-2,6-7H2,3-4H3,(H,12,13).
What are the key properties of 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine?
5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine has a molecular weight of 176.26 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-enyl-2,4-dimethyl-6-methylidene-1H-pyrimidine is sourced from PubChem (CID 155243022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).