C19H11Cl3N6O — CID 155243051
8-[5-[3,5-dichloro-4-(chloromethyl)phenyl]-1,3-benzoxazol-2-yl]-7H-purin-6-amine (PubChem CID 155243051) has the molecular formula C19H11Cl3N6O and a molecular weight of 445.70 g/mol. Its IUPAC name is 8-[5-[3,5-dichloro-4-(chloromethyl)phenyl]-1,3-benzoxazol-2-yl]-7H-purin-6-amine.
| Compound Name | 8-[5-[3,5-dichloro-4-(chloromethyl)phenyl]-1,3-benzoxazol-2-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 155243051 |
| Molecular Formula | C19H11Cl3N6O |
| Molecular Weight | 445.70 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 8-[5-[3,5-dichloro-4-(chloromethyl)phenyl]-1,3-benzoxazol-2-yl]-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(-c3nc4cc(-c5cc(Cl)c(CCl)c(Cl)c5)ccc4o3)[nH]c12 |
| InChI | InChI=1S/C19H11Cl3N6O/c20-6-10-11(21)3-9(4-12(10)22)8-1-2-14-13(5-8)26-19(29-14)18-27-15-16(23)24-7-25-17(15)28-18/h1-5,7H,6H2,(H3,23,24,25,27,28) |
| InChIKey | NDGKZLHKFBZWDE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|