About (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine
(3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine (PubChem CID 155244304) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine.
Molecular Properties
| Compound Name | (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine |
| PubChem CID | 155244304 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine |
| SMILES | C/C=C\C(=C/C)[C@H]1COCCN1 |
| InChI | InChI=1S/C10H17NO/c1-3-5-9(4-2)10-8-12-7-6-11-10/h3-5,10-11H,6-8H2,1-2H3/b5-3-,9-4+/t10-/m1/s1 |
| InChIKey | DHLMZQMCNKZFML-DIVIDFTJSA-N |
| XLogP | 1.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine?
The IUPAC name of (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine (CID 155244304) is (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine.
What is the SMILES notation for (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine?
The canonical SMILES for (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine is C/C=C\C(=C/C)[C@H]1COCCN1.
What is the InChIKey of (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine?
The InChIKey is DHLMZQMCNKZFML-DIVIDFTJSA-N. The full InChI is InChI=1S/C10H17NO/c1-3-5-9(4-2)10-8-12-7-6-11-10/h3-5,10-11H,6-8H2,1-2H3/b5-3-,9-4+/t10-/m1/s1.
What are the key properties of (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine?
(3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine has a molecular weight of 167.25 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine is sourced from PubChem (CID 155244304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).