C28H28N6O3 — CID 155244351
(3R)-3-quinoxalin-2-yl-3-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indazol-1-yl]propane-1,1-diol (PubChem CID 155244351) has the molecular formula C28H28N6O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is (3R)-3-quinoxalin-2-yl-3-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indazol-1-yl]propane-1,1-diol.
| Compound Name | (3R)-3-quinoxalin-2-yl-3-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indazol-1-yl]propane-1,1-diol |
|---|---|
| PubChem CID | 155244351 |
| Molecular Formula | C28H28N6O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (3R)-3-quinoxalin-2-yl-3-[5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]indazol-1-yl]propane-1,1-diol |
| SMILES | OC(O)C[C@H](c1cnc2ccccc2n1)n1ncc2cc(OCCc3ccc4c(n3)NCCC4)ccc21 |
| InChI | InChI=1S/C28H28N6O3/c35-27(36)15-26(24-17-30-22-5-1-2-6-23(22)33-24)34-25-10-9-21(14-19(25)16-31-34)37-13-11-20-8-7-18-4-3-12-29-28(18)32-20/h1-2,5-10,14,16-17,26-27,35-36H,3-4,11-13,15H2,(H,29,32)/t26-/m1/s1 |
| InChIKey | CXRWLYGCGORGGQ-AREMUKBSSA-N |
| XLogP | 3.64 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|