C33H45N5O3 — CID 155244610
1-[7-[6,7-dicyclopropyl-8-(2-methoxyethoxy)-2-(1-methylpiperidin-4-yl)quinazolin-4-yl]-2,7-diazaspiro[3.5]nonan-2-yl]prop-2-en-1-one (PubChem CID 155244610) has the molecular formula C33H45N5O3 and a molecular weight of 559.76 g/mol. Its IUPAC name is 1-[7-[6,7-dicyclopropyl-8-(2-methoxyethoxy)-2-(1-methylpiperidin-4-yl)quinazolin-4-yl]-2,7-diazaspiro[3.5]nonan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[6,7-dicyclopropyl-8-(2-methoxyethoxy)-2-(1-methylpiperidin-4-yl)quinazolin-4-yl]-2,7-diazaspiro[3.5]nonan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155244610 |
| Molecular Formula | C33H45N5O3 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 559.35 |
| IUPAC Name | 1-[7-[6,7-dicyclopropyl-8-(2-methoxyethoxy)-2-(1-methylpiperidin-4-yl)quinazolin-4-yl]-2,7-diazaspiro[3.5]nonan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc(C4CCN(C)CC4)nc4c(OCCOC)c(C5CC5)c(C5CC5)cc34)CC2)C1 |
| InChI | InChI=1S/C33H45N5O3/c1-4-27(39)38-20-33(21-38)11-15-37(16-12-33)32-26-19-25(22-5-6-22)28(23-7-8-23)30(41-18-17-40-3)29(26)34-31(35-32)24-9-13-36(2)14-10-24/h4,19,22-24H,1,5-18,20-21H2,2-3H3 |
| InChIKey | CRUXMRFSLFNVIN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|