C23H37N7O3S — CID 155244979
(Z)-3-amino-N'-[2-[[(1R,5S)-9-ethylsulfonyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-6-(oxolan-2-yl)pyrimidin-4-yl]but-2-enimidamide (PubChem CID 155244979) has the molecular formula C23H37N7O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is (Z)-3-amino-N'-[2-[[(1R,5S)-9-ethylsulfonyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-6-(oxolan-2-yl)pyrimidin-4-yl]but-2-enimidamide.
| Compound Name | (Z)-3-amino-N'-[2-[[(1R,5S)-9-ethylsulfonyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-6-(oxolan-2-yl)pyrimidin-4-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 155244979 |
| Molecular Formula | C23H37N7O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (Z)-3-amino-N'-[2-[[(1R,5S)-9-ethylsulfonyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-6-(oxolan-2-yl)pyrimidin-4-yl]but-2-enimidamide |
| SMILES | CCS(=O)(=O)N1[C@@H]2CCC[C@H]1CC(N(C)c1nc(/N=C(N)/C=C(/C)N)cc(C3CCCO3)n1)C2 |
| InChI | InChI=1S/C23H37N7O3S/c1-4-34(31,32)30-16-7-5-8-17(30)13-18(12-16)29(3)23-26-19(20-9-6-10-33-20)14-22(28-23)27-21(25)11-15(2)24/h11,14,16-18,20H,4-10,12-13,24H2,1-3H3,(H2,25,26,27,28)/b15-11-/t16-,17+,18?,20? |
| InChIKey | AKQUYDRCHHHQJB-FPCVGPSLSA-N |
| XLogP | 2.35 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|