About 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran
5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran (PubChem CID 15524505) has the molecular formula C14H17FO
and a molecular weight of 220.29 g/mol. Its IUPAC name is 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran |
| PubChem CID | 15524505 |
| Molecular Formula | C14H17FO |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran |
| SMILES | CC1COC(F)=C1CC(C)c1ccccc1 |
| InChI | InChI=1S/C14H17FO/c1-10(12-6-4-3-5-7-12)8-13-11(2)9-16-14(13)15/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | HVUCRQOQZODWMO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran?
The IUPAC name of 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran (CID 15524505) is 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran.
What is the SMILES notation for 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran?
The canonical SMILES for 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran is CC1COC(F)=C1CC(C)c1ccccc1.
What is the InChIKey of 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran?
The InChIKey is HVUCRQOQZODWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FO/c1-10(12-6-4-3-5-7-12)8-13-11(2)9-16-14(13)15/h3-7,10-11H,8-9H2,1-2H3.
What are the key properties of 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran?
5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran has a molecular weight of 220.29 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-methyl-4-(2-phenylpropyl)-2,3-dihydrofuran is sourced from PubChem (CID 15524505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).