C27H23NO6S — CID 15524519
ethyl 2-(4-methylphenyl)sulfonyl-7,12-dioxo-3,4-dihydro-1H-naphtho[2,3-h]isoquinoline-3-carboxylate (PubChem CID 15524519) has the molecular formula C27H23NO6S and a molecular weight of 489.55 g/mol. Its IUPAC name is ethyl 2-(4-methylphenyl)sulfonyl-7,12-dioxo-3,4-dihydro-1H-naphtho[2,3-h]isoquinoline-3-carboxylate.
| Compound Name | ethyl 2-(4-methylphenyl)sulfonyl-7,12-dioxo-3,4-dihydro-1H-naphtho[2,3-h]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 15524519 |
| Molecular Formula | C27H23NO6S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | ethyl 2-(4-methylphenyl)sulfonyl-7,12-dioxo-3,4-dihydro-1H-naphtho[2,3-h]isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1Cc2ccc3c(c2CN1S(=O)(=O)c1ccc(C)cc1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C27H23NO6S/c1-3-34-27(31)23-14-17-10-13-21-24(26(30)20-7-5-4-6-19(20)25(21)29)22(17)15-28(23)35(32,33)18-11-8-16(2)9-12-18/h4-13,23H,3,14-15H2,1-2H3 |
| InChIKey | CTKLQOWKUQKJGE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|