About 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine
6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine (PubChem CID 155245230) has the molecular formula C9H11FN4
and a molecular weight of 194.21 g/mol. Its IUPAC name is 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine.
Molecular Properties
| Compound Name | 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine |
| PubChem CID | 155245230 |
| Molecular Formula | C9H11FN4 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine |
| SMILES | CC1CCc2ncnc(N)c2N=C1F |
| InChI | InChI=1S/C9H11FN4/c1-5-2-3-6-7(14-8(5)10)9(11)13-4-12-6/h4-5H,2-3H2,1H3,(H2,11,12,13) |
| InChIKey | RBMBALZBORFFHO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine?
The IUPAC name of 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine (CID 155245230) is 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine.
What is the SMILES notation for 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine?
The canonical SMILES for 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine is CC1CCc2ncnc(N)c2N=C1F.
What is the InChIKey of 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine?
The InChIKey is RBMBALZBORFFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN4/c1-5-2-3-6-7(14-8(5)10)9(11)13-4-12-6/h4-5H,2-3H2,1H3,(H2,11,12,13).
What are the key properties of 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine?
6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine has a molecular weight of 194.21 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine is sourced from PubChem (CID 155245230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).