C22H23F3N4O3S — CID 155246044
4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-N-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1H-pyridine-5-carbothioamide (PubChem CID 155246044) has the molecular formula C22H23F3N4O3S and a molecular weight of 480.51 g/mol. Its IUPAC name is 4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-N-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1H-pyridine-5-carbothioamide.
| Compound Name | 4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-N-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1H-pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 155246044 |
| Molecular Formula | C22H23F3N4O3S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-N-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1H-pyridine-5-carbothioamide |
| SMILES | COCCOc1cnccc1CNC1=C(C(=S)Nc2ccccc2C(F)(F)F)C(=O)NCC1 |
| InChI | InChI=1S/C22H23F3N4O3S/c1-31-10-11-32-18-13-26-8-6-14(18)12-28-17-7-9-27-20(30)19(17)21(33)29-16-5-3-2-4-15(16)22(23,24)25/h2-6,8,13,28H,7,9-12H2,1H3,(H,27,30)(H,29,33) |
| InChIKey | OAPNYQNHYJXSFT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|