C30H30N4O6 — CID 155248210
(5Z)-5-[(2E)-2-[3,3-dimethyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]ethylidene]-1-(2-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 155248210) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is (5Z)-5-[(2E)-2-[3,3-dimethyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]ethylidene]-1-(2-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[(2E)-2-[3,3-dimethyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]ethylidene]-1-(2-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155248210 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | (5Z)-5-[(2E)-2-[3,3-dimethyl-5-nitro-1-(2-phenoxyethyl)indol-2-ylidene]ethylidene]-1-(2-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(CC(C)O)C(=O)/C1=C\C=C1\N(CCOc2ccccc2)c2ccc([N+](=O)[O-])cc2C1(C)C |
| InChI | InChI=1S/C30H30N4O6/c1-19(35)18-33-28(36)23(20(2)24(17-31)29(33)37)11-13-27-30(3,4)25-16-21(34(38)39)10-12-26(25)32(27)14-15-40-22-8-6-5-7-9-22/h5-13,16,19,35H,14-15,18H2,1-4H3/b23-11-,27-13+ |
| InChIKey | KLQBNYZYWCYEBT-PJELIWKHSA-N |
| XLogP | 4.17 |
| TPSA | 137.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|