2,8-dimethylquinolizin-4-one

C11H11NO — CID 155248244

IUPAC2,8-dimethylquinolizin-4-one
SMILESCc1ccn2c(=O)cc(C)cc2c1
InChIInChI=1S/C11H11NO/c1-8-3-4-12-10(5-8)6-9(2)7-11(12)13/h3-7H,1-2H3
InChIKeyRMXSVQFVUCPPFA-UHFFFAOYSA-N
MW173.21 g/mol
LogP1.92
Rot. Bonds

About 2,8-dimethylquinolizin-4-one

2,8-dimethylquinolizin-4-one (PubChem CID 155248244) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 2,8-dimethylquinolizin-4-one.

Molecular Properties

Compound Name2,8-dimethylquinolizin-4-one
PubChem CID155248244
Molecular FormulaC11H11NO
Molecular Weight173.21 g/mol
Exact Mass173.08
IUPAC Name2,8-dimethylquinolizin-4-one
SMILESCc1ccn2c(=O)cc(C)cc2c1
InChIInChI=1S/C11H11NO/c1-8-3-4-12-10(5-8)6-9(2)7-11(12)13/h3-7H,1-2H3
InChIKeyRMXSVQFVUCPPFA-UHFFFAOYSA-N
XLogP1.92
TPSA21.48 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.21
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2,8-dimethylquinolizin-4-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 2426546
CID 2426546
CID 12435498
CID 12435498
CID 12435499
CID 12435499
CID 12435501
CID 12435501
CID 12735847
CID 12735847
CID 13169254
CID 13169254
CID 14323033
CID 14323033
CID 21538594
CID 21538594
CID 45082947
CID 45082947
CID 134908898
CID 134908898
CID 59284176
CID 59284176
CID 71032511
CID 71032511

Frequently Asked Questions

What is the IUPAC name of 2,8-dimethylquinolizin-4-one?
The IUPAC name of 2,8-dimethylquinolizin-4-one (CID 155248244) is 2,8-dimethylquinolizin-4-one.
What is the SMILES notation for 2,8-dimethylquinolizin-4-one?
The canonical SMILES for 2,8-dimethylquinolizin-4-one is Cc1ccn2c(=O)cc(C)cc2c1.
What is the InChIKey of 2,8-dimethylquinolizin-4-one?
The InChIKey is RMXSVQFVUCPPFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-8-3-4-12-10(5-8)6-9(2)7-11(12)13/h3-7H,1-2H3.
What are the key properties of 2,8-dimethylquinolizin-4-one?
2,8-dimethylquinolizin-4-one has a molecular weight of 173.21 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethylquinolizin-4-one is sourced from PubChem (CID 155248244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).