C29H32F3N3O4 — CID 155248299
(4aE,9Z)-5-hydroxy-2-(3-methoxypropyl)-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3-(2,2,2-trifluoroethyl)-6,8-dihydro-2H-[1,2,4]triazino[6,1-d][1,5]oxazocin-4-one (PubChem CID 155248299) has the molecular formula C29H32F3N3O4 and a molecular weight of 543.59 g/mol. Its IUPAC name is (4aE,9Z)-5-hydroxy-2-(3-methoxypropyl)-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3-(2,2,2-trifluoroethyl)-6,8-dihydro-2H-[1,2,4]triazino[6,1-d][1,5]oxazocin-4-one.
| Compound Name | (4aE,9Z)-5-hydroxy-2-(3-methoxypropyl)-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3-(2,2,2-trifluoroethyl)-6,8-dihydro-2H-[1,2,4]triazino[6,1-d][1,5]oxazocin-4-one |
|---|---|
| PubChem CID | 155248299 |
| Molecular Formula | C29H32F3N3O4 |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | (4aE,9Z)-5-hydroxy-2-(3-methoxypropyl)-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3-(2,2,2-trifluoroethyl)-6,8-dihydro-2H-[1,2,4]triazino[6,1-d][1,5]oxazocin-4-one |
| SMILES | COCCCC1N(CC(F)(F)F)C(=O)/C2=C(\O)COC/C=C\N2N1C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C29H32F3N3O4/c1-38-16-6-12-25-33(19-29(30,31)32)28(37)27-24(36)18-39-17-7-15-34(27)35(25)26-22-10-4-2-8-20(22)13-14-21-9-3-5-11-23(21)26/h2-5,7-11,15,25-26,36H,6,12-14,16-19H2,1H3/b15-7-,27-24+ |
| InChIKey | DHXUNEIVTAJSQU-VKTSJCODSA-N |
| XLogP | 4.86 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|