C22H8N2O6 — CID 155248671
17-hydroxy-7,18-dioxa-11,22-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,19-trione (PubChem CID 155248671) has the molecular formula C22H8N2O6 and a molecular weight of 396.31 g/mol. Its IUPAC name is 17-hydroxy-7,18-dioxa-11,22-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,19-trione.
| Compound Name | 17-hydroxy-7,18-dioxa-11,22-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,19-trione |
|---|---|
| PubChem CID | 155248671 |
| Molecular Formula | C22H8N2O6 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 17-hydroxy-7,18-dioxa-11,22-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,19-trione |
| SMILES | O=C1OC(=O)c2cnc3c4ccc5c6c(cnc(c7ccc1c2c73)c64)C(=O)OC5O |
| InChI | InChI=1S/C22H8N2O6/c25-19-9-3-1-7-15-13(9)11(21(27)29-19)6-24-18(15)8-2-4-10-14-12(22(28)30-20(10)26)5-23-17(7)16(8)14/h1-6,19,25H |
| InChIKey | KCINUXVSNFWLFY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|