C19H23ClN2O5S — CID 155248832
1-(3-tert-butylsulfonyl-4-chloro-2-hydroxyphenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea (PubChem CID 155248832) has the molecular formula C19H23ClN2O5S and a molecular weight of 426.92 g/mol. Its IUPAC name is 1-(3-tert-butylsulfonyl-4-chloro-2-hydroxyphenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea.
| Compound Name | 1-(3-tert-butylsulfonyl-4-chloro-2-hydroxyphenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
|---|---|
| PubChem CID | 155248832 |
| Molecular Formula | C19H23ClN2O5S |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-(3-tert-butylsulfonyl-4-chloro-2-hydroxyphenyl)-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
| SMILES | CC(C)(C)S(=O)(=O)c1c(Cl)ccc(NC(=O)NC2CCCc3ccoc32)c1O |
| InChI | InChI=1S/C19H23ClN2O5S/c1-19(2,3)28(25,26)17-12(20)7-8-13(15(17)23)21-18(24)22-14-6-4-5-11-9-10-27-16(11)14/h7-10,14,23H,4-6H2,1-3H3,(H2,21,22,24) |
| InChIKey | MVNJBRMINOTNLH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|