C21H26ClN3O5S — CID 155248842
1-[4-chloro-2-hydroxy-3-[(3S)-piperidin-3-yl]sulfonylphenyl]-3-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea (PubChem CID 155248842) has the molecular formula C21H26ClN3O5S and a molecular weight of 467.98 g/mol. Its IUPAC name is 1-[4-chloro-2-hydroxy-3-[(3S)-piperidin-3-yl]sulfonylphenyl]-3-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea.
| Compound Name | 1-[4-chloro-2-hydroxy-3-[(3S)-piperidin-3-yl]sulfonylphenyl]-3-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
|---|---|
| PubChem CID | 155248842 |
| Molecular Formula | C21H26ClN3O5S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 1-[4-chloro-2-hydroxy-3-[(3S)-piperidin-3-yl]sulfonylphenyl]-3-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
| SMILES | Cc1cc2c(o1)C(NC(=O)Nc1ccc(Cl)c(S(=O)(=O)[C@H]3CCCNC3)c1O)CCC2 |
| InChI | InChI=1S/C21H26ClN3O5S/c1-12-10-13-4-2-6-17(19(13)30-12)25-21(27)24-16-8-7-15(22)20(18(16)26)31(28,29)14-5-3-9-23-11-14/h7-8,10,14,17,23,26H,2-6,9,11H2,1H3,(H2,24,25,27)/t14-,17?/m0/s1 |
| InChIKey | KGOOMSGIRGQVIN-MBIQTGHCSA-N |
| XLogP | 3.67 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|