C19H21ClN2O5S — CID 155248846
1-(4-chloro-3-cyclopropylsulfonyl-2-hydroxyphenyl)-3-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea (PubChem CID 155248846) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is 1-(4-chloro-3-cyclopropylsulfonyl-2-hydroxyphenyl)-3-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea.
| Compound Name | 1-(4-chloro-3-cyclopropylsulfonyl-2-hydroxyphenyl)-3-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
|---|---|
| PubChem CID | 155248846 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 1-(4-chloro-3-cyclopropylsulfonyl-2-hydroxyphenyl)-3-(2-methyl-4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
| SMILES | Cc1cc2c(o1)C(NC(=O)Nc1ccc(Cl)c(S(=O)(=O)C3CC3)c1O)CCC2 |
| InChI | InChI=1S/C19H21ClN2O5S/c1-10-9-11-3-2-4-15(17(11)27-10)22-19(24)21-14-8-7-13(20)18(16(14)23)28(25,26)12-5-6-12/h7-9,12,15,23H,2-6H2,1H3,(H2,21,22,24) |
| InChIKey | VTDSGZLTWAIFAR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|