C22H28ClN3O5S — CID 155248849
1-[4-chloro-3-(2,2-dimethylpiperidin-3-yl)sulfonyl-2-hydroxyphenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea (PubChem CID 155248849) has the molecular formula C22H28ClN3O5S and a molecular weight of 482.00 g/mol. Its IUPAC name is 1-[4-chloro-3-(2,2-dimethylpiperidin-3-yl)sulfonyl-2-hydroxyphenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea.
| Compound Name | 1-[4-chloro-3-(2,2-dimethylpiperidin-3-yl)sulfonyl-2-hydroxyphenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
|---|---|
| PubChem CID | 155248849 |
| Molecular Formula | C22H28ClN3O5S |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 1-[4-chloro-3-(2,2-dimethylpiperidin-3-yl)sulfonyl-2-hydroxyphenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
| SMILES | CC1(C)NCCCC1S(=O)(=O)c1c(Cl)ccc(NC(=O)NC2CCCc3ccoc32)c1O |
| InChI | InChI=1S/C22H28ClN3O5S/c1-22(2)17(7-4-11-24-22)32(29,30)20-14(23)8-9-15(18(20)27)25-21(28)26-16-6-3-5-13-10-12-31-19(13)16/h8-10,12,16-17,24,27H,3-7,11H2,1-2H3,(H2,25,26,28) |
| InChIKey | OGIPFTPNYHBLPU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|