About methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate
methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate (PubChem CID 155248935) has the molecular formula C15H30N2O2
and a molecular weight of 270.42 g/mol. Its IUPAC name is methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate.
Molecular Properties
| Compound Name | methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate |
| PubChem CID | 155248935 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate |
| SMILES | C=C(NCC(C)C)C(C)(C)CC(C)(N)CC(=O)OC |
| InChI | InChI=1S/C15H30N2O2/c1-11(2)9-17-12(3)14(4,5)10-15(6,16)8-13(18)19-7/h11,17H,3,8-10,16H2,1-2,4-7H3 |
| InChIKey | BRNIIOKQPUPJRU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate?
The IUPAC name of methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate (CID 155248935) is methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate.
What is the SMILES notation for methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate?
The canonical SMILES for methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate is C=C(NCC(C)C)C(C)(C)CC(C)(N)CC(=O)OC.
What is the InChIKey of methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate?
The InChIKey is BRNIIOKQPUPJRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O2/c1-11(2)9-17-12(3)14(4,5)10-15(6,16)8-13(18)19-7/h11,17H,3,8-10,16H2,1-2,4-7H3.
What are the key properties of methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate?
methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate has a molecular weight of 270.42 g/mol, XLogP of 2.44, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-3,5,5-trimethyl-6-(2-methylpropylamino)hept-6-enoate is sourced from PubChem (CID 155248935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).