C17H20ClN3O5S — CID 155248984
1-[3-(2-aminoethylsulfonyl)-4-chloro-2-hydroxyphenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea (PubChem CID 155248984) has the molecular formula C17H20ClN3O5S and a molecular weight of 413.88 g/mol. Its IUPAC name is 1-[3-(2-aminoethylsulfonyl)-4-chloro-2-hydroxyphenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea.
| Compound Name | 1-[3-(2-aminoethylsulfonyl)-4-chloro-2-hydroxyphenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
|---|---|
| PubChem CID | 155248984 |
| Molecular Formula | C17H20ClN3O5S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 1-[3-(2-aminoethylsulfonyl)-4-chloro-2-hydroxyphenyl]-3-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)urea |
| SMILES | NCCS(=O)(=O)c1c(Cl)ccc(NC(=O)NC2CCCc3ccoc32)c1O |
| InChI | InChI=1S/C17H20ClN3O5S/c18-11-4-5-12(14(22)16(11)27(24,25)9-7-19)20-17(23)21-13-3-1-2-10-6-8-26-15(10)13/h4-6,8,13,22H,1-3,7,9,19H2,(H2,20,21,23) |
| InChIKey | OMHOJACAYPZAFM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|