C17H16ClF3N2O5S — CID 155248993
1-[4-chloro-2-hydroxy-3-(2,2,2-trifluoroethylsulfonyl)phenyl]-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea (PubChem CID 155248993) has the molecular formula C17H16ClF3N2O5S and a molecular weight of 452.84 g/mol. Its IUPAC name is 1-[4-chloro-2-hydroxy-3-(2,2,2-trifluoroethylsulfonyl)phenyl]-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea.
| Compound Name | 1-[4-chloro-2-hydroxy-3-(2,2,2-trifluoroethylsulfonyl)phenyl]-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea |
|---|---|
| PubChem CID | 155248993 |
| Molecular Formula | C17H16ClF3N2O5S |
| Molecular Weight | 452.84 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 1-[4-chloro-2-hydroxy-3-(2,2,2-trifluoroethylsulfonyl)phenyl]-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)CC(F)(F)F)c1O)N[C@H]1CCCc2ccoc21 |
| InChI | InChI=1S/C17H16ClF3N2O5S/c18-10-4-5-11(13(24)15(10)29(26,27)8-17(19,20)21)22-16(25)23-12-3-1-2-9-6-7-28-14(9)12/h4-7,12,24H,1-3,8H2,(H2,22,23,25)/t12-/m0/s1 |
| InChIKey | FWKPLWSZVZZWTE-LBPRGKRZSA-N |
| XLogP | 4.17 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|