About 1,3-bis(3,5-diphenylphenyl)propan-2-one
1,3-bis(3,5-diphenylphenyl)propan-2-one (PubChem CID 15524959) has the molecular formula C39H30O
and a molecular weight of 514.67 g/mol. Its IUPAC name is 1,3-bis(3,5-diphenylphenyl)propan-2-one.
Molecular Properties
| Compound Name | 1,3-bis(3,5-diphenylphenyl)propan-2-one |
| PubChem CID | 15524959 |
| Molecular Formula | C39H30O |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 1,3-bis(3,5-diphenylphenyl)propan-2-one |
| SMILES | O=C(Cc1cc(-c2ccccc2)cc(-c2ccccc2)c1)Cc1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C39H30O/c40-39(25-29-21-35(31-13-5-1-6-14-31)27-36(22-29)32-15-7-2-8-16-32)26-30-23-37(33-17-9-3-10-18-33)28-38(24-30)34-19-11-4-12-20-34/h1-24,27-28H,25-26H2 |
| InChIKey | ZXCNORZNGPANRS-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-bis(3,5-diphenylphenyl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(3,5-diphenylphenyl)propan-2-one?
The IUPAC name of 1,3-bis(3,5-diphenylphenyl)propan-2-one (CID 15524959) is 1,3-bis(3,5-diphenylphenyl)propan-2-one.
What is the SMILES notation for 1,3-bis(3,5-diphenylphenyl)propan-2-one?
The canonical SMILES for 1,3-bis(3,5-diphenylphenyl)propan-2-one is O=C(Cc1cc(-c2ccccc2)cc(-c2ccccc2)c1)Cc1cc(-c2ccccc2)cc(-c2ccccc2)c1.
What is the InChIKey of 1,3-bis(3,5-diphenylphenyl)propan-2-one?
The InChIKey is ZXCNORZNGPANRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H30O/c40-39(25-29-21-35(31-13-5-1-6-14-31)27-36(22-29)32-15-7-2-8-16-32)26-30-23-37(33-17-9-3-10-18-33)28-38(24-30)34-19-11-4-12-20-34/h1-24,27-28H,25-26H2.
What are the key properties of 1,3-bis(3,5-diphenylphenyl)propan-2-one?
1,3-bis(3,5-diphenylphenyl)propan-2-one has a molecular weight of 514.67 g/mol, XLogP of 9.71, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(3,5-diphenylphenyl)propan-2-one is sourced from PubChem (CID 15524959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).