C29H24F3N5O — CID 155249689
9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 155249689) has the molecular formula C29H24F3N5O and a molecular weight of 515.54 g/mol. Its IUPAC name is 9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 155249689 |
| Molecular Formula | C29H24F3N5O |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | CN1CCN(c2ccc(-c3ccc4ncc5ccc(=O)n(-c6cccc(C(F)(F)F)c6)c5c4c3)cn2)CC1 |
| InChI | InChI=1S/C29H24F3N5O/c1-35-11-13-36(14-12-35)26-9-6-20(17-34-26)19-5-8-25-24(15-19)28-21(18-33-25)7-10-27(38)37(28)23-4-2-3-22(16-23)29(30,31)32/h2-10,15-18H,11-14H2,1H3 |
| InChIKey | IPXKWCLGNKSEKG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|