About [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane
[(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane (PubChem CID 15524989) has the molecular formula C17H34OSi
and a molecular weight of 282.54 g/mol. Its IUPAC name is [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane |
| PubChem CID | 15524989 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane |
| SMILES | C/C=C/C=C\CCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H34OSi/c1-8-9-10-11-12-13-14-18-19(15(2)3,16(4)5)17(6)7/h8-11,15-17H,12-14H2,1-7H3/b9-8+,11-10- |
| InChIKey | FDUOTWULDUPINU-OCBXPSTGSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane?
The IUPAC name of [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane (CID 15524989) is [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane.
What is the SMILES notation for [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane?
The canonical SMILES for [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane is C/C=C/C=C\CCCO[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane?
The InChIKey is FDUOTWULDUPINU-OCBXPSTGSA-N. The full InChI is InChI=1S/C17H34OSi/c1-8-9-10-11-12-13-14-18-19(15(2)3,16(4)5)17(6)7/h8-11,15-17H,12-14H2,1-7H3/b9-8+,11-10-.
What are the key properties of [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane?
[(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane has a molecular weight of 282.54 g/mol, XLogP of 6.09, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z,6E)-octa-4,6-dienoxy]-tri(propan-2-yl)silane is sourced from PubChem (CID 15524989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).