About [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane
[(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane (PubChem CID 15524990) has the molecular formula C19H38OSi
and a molecular weight of 310.60 g/mol. Its IUPAC name is [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane |
| PubChem CID | 15524990 |
| Molecular Formula | C19H38OSi |
| Molecular Weight | 310.60 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane |
| SMILES | CCC/C=C/C=C\CCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H38OSi/c1-8-9-10-11-12-13-14-15-16-20-21(17(2)3,18(4)5)19(6)7/h10-13,17-19H,8-9,14-16H2,1-7H3/b11-10+,13-12- |
| InChIKey | SVGHVXJPAPZRCV-MRBUWEIXSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.60 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane?
The IUPAC name of [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane (CID 15524990) is [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane.
What is the SMILES notation for [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane?
The canonical SMILES for [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane is CCC/C=C/C=C\CCCO[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane?
The InChIKey is SVGHVXJPAPZRCV-MRBUWEIXSA-N. The full InChI is InChI=1S/C19H38OSi/c1-8-9-10-11-12-13-14-15-16-20-21(17(2)3,18(4)5)19(6)7/h10-13,17-19H,8-9,14-16H2,1-7H3/b11-10+,13-12-.
What are the key properties of [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane?
[(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane has a molecular weight of 310.60 g/mol, XLogP of 6.87, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z,6E)-deca-4,6-dienoxy]-tri(propan-2-yl)silane is sourced from PubChem (CID 15524990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).