C21H25F3N4O5 — CID 155250300
4-[4-(4-pyrrolidin-1-ylphenyl)cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 155250300) has the molecular formula C21H25F3N4O5 and a molecular weight of 470.45 g/mol. Its IUPAC name is 4-[4-(4-pyrrolidin-1-ylphenyl)cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-(4-pyrrolidin-1-ylphenyl)cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155250300 |
| Molecular Formula | C21H25F3N4O5 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 4-[4-(4-pyrrolidin-1-ylphenyl)cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1[nH]nnc1OC1CCC(c2ccc(N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H24N4O3.C2HF3O2/c24-19(25)17-18(21-22-20-17)26-16-9-5-14(6-10-16)13-3-7-15(8-4-13)23-11-1-2-12-23;3-2(4,5)1(6)7/h3-4,7-8,14,16H,1-2,5-6,9-12H2,(H,24,25)(H,20,21,22);(H,6,7) |
| InChIKey | XPTOZZFWORIRFR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|