C22H25F5N4O5 — CID 155250303
4-[4-[4-(4,4-difluoropiperidin-1-yl)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 155250303) has the molecular formula C22H25F5N4O5 and a molecular weight of 520.46 g/mol. Its IUPAC name is 4-[4-[4-(4,4-difluoropiperidin-1-yl)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-[4-(4,4-difluoropiperidin-1-yl)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155250303 |
| Molecular Formula | C22H25F5N4O5 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 4-[4-[4-(4,4-difluoropiperidin-1-yl)phenyl]cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1[nH]nnc1OC1CCC(c2ccc(N3CCC(F)(F)CC3)cc2)CC1 |
| InChI | InChI=1S/C20H24F2N4O3.C2HF3O2/c21-20(22)9-11-26(12-10-20)15-5-1-13(2-6-15)14-3-7-16(8-4-14)29-18-17(19(27)28)23-25-24-18;3-2(4,5)1(6)7/h1-2,5-6,14,16H,3-4,7-12H2,(H,27,28)(H,23,24,25);(H,6,7) |
| InChIKey | NQIHFTJLXSCDML-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|