C22H27F3N4O5 — CID 155250409
4-[4-(4-piperidin-1-ylphenyl)cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 155250409) has the molecular formula C22H27F3N4O5 and a molecular weight of 484.48 g/mol. Its IUPAC name is 4-[4-(4-piperidin-1-ylphenyl)cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-(4-piperidin-1-ylphenyl)cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155250409 |
| Molecular Formula | C22H27F3N4O5 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 4-[4-(4-piperidin-1-ylphenyl)cyclohexyl]oxy-1H-triazole-5-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1[nH]nnc1OC1CCC(c2ccc(N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C20H26N4O3.C2HF3O2/c25-20(26)18-19(22-23-21-18)27-17-10-6-15(7-11-17)14-4-8-16(9-5-14)24-12-2-1-3-13-24;3-2(4,5)1(6)7/h4-5,8-9,15,17H,1-3,6-7,10-13H2,(H,25,26)(H,21,22,23);(H,6,7) |
| InChIKey | FUYZTXAEFNIWIR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|