C20H21F3N4O4 — CID 155250456
(2,2,2-trifluoroacetyl) 4-[3-(4-piperidin-1-ylphenyl)cyclobutyl]oxy-1H-triazole-5-carboxylate (PubChem CID 155250456) has the molecular formula C20H21F3N4O4 and a molecular weight of 438.41 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[3-(4-piperidin-1-ylphenyl)cyclobutyl]oxy-1H-triazole-5-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[3-(4-piperidin-1-ylphenyl)cyclobutyl]oxy-1H-triazole-5-carboxylate |
|---|---|
| PubChem CID | 155250456 |
| Molecular Formula | C20H21F3N4O4 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[3-(4-piperidin-1-ylphenyl)cyclobutyl]oxy-1H-triazole-5-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1[nH]nnc1OC1CC(c2ccc(N3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C20H21F3N4O4/c21-20(22,23)19(29)31-18(28)16-17(25-26-24-16)30-15-10-13(11-15)12-4-6-14(7-5-12)27-8-2-1-3-9-27/h4-7,13,15H,1-3,8-11H2,(H,24,25,26) |
| InChIKey | TZXLTQJNHALWKY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|