About (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate
(2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate (PubChem CID 155250475) has the molecular formula C17H15ClF3N3O5
and a molecular weight of 433.77 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate.
Molecular Properties
| Compound Name | (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate |
| PubChem CID | 155250475 |
| Molecular Formula | C17H15ClF3N3O5 |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1[nH]nnc1Oc1ccc(Cl)c(OC2CCCCC2)c1 |
| InChI | InChI=1S/C17H15ClF3N3O5/c18-11-7-6-10(8-12(11)27-9-4-2-1-3-5-9)28-14-13(22-24-23-14)15(25)29-16(26)17(19,20)21/h6-9H,1-5H2,(H,22,23,24) |
| InChIKey | FZGCAGADZLECKS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate?
The IUPAC name of (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate (CID 155250475) is (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate.
What is the SMILES notation for (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate?
The canonical SMILES for (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate is O=C(OC(=O)C(F)(F)F)c1[nH]nnc1Oc1ccc(Cl)c(OC2CCCCC2)c1.
What is the InChIKey of (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate?
The InChIKey is FZGCAGADZLECKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClF3N3O5/c18-11-7-6-10(8-12(11)27-9-4-2-1-3-5-9)28-14-13(22-24-23-14)15(25)29-16(26)17(19,20)21/h6-9H,1-5H2,(H,22,23,24).
What are the key properties of (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate?
(2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate has a molecular weight of 433.77 g/mol, XLogP of 4.21, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,2-trifluoroacetyl) 4-(4-chloro-3-cyclohexyloxyphenoxy)-1H-triazole-5-carboxylate is sourced from PubChem (CID 155250475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).