About 2-acridin-9-ylacetic acid
2-acridin-9-ylacetic acid (PubChem CID 15525099) has the molecular formula C15H11NO2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-acridin-9-ylacetic acid.
Molecular Properties
| Compound Name | 2-acridin-9-ylacetic acid |
| PubChem CID | 15525099 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-acridin-9-ylacetic acid |
| SMILES | O=C(O)Cc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C15H11NO2/c17-15(18)9-12-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8H,9H2,(H,17,18) |
| InChIKey | QTKFSQNJSBQUPW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-acridin-9-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acridin-9-ylacetic acid?
The IUPAC name of 2-acridin-9-ylacetic acid (CID 15525099) is 2-acridin-9-ylacetic acid.
What is the SMILES notation for 2-acridin-9-ylacetic acid?
The canonical SMILES for 2-acridin-9-ylacetic acid is O=C(O)Cc1c2ccccc2nc2ccccc12.
What is the InChIKey of 2-acridin-9-ylacetic acid?
The InChIKey is QTKFSQNJSBQUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2/c17-15(18)9-12-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8H,9H2,(H,17,18).
What are the key properties of 2-acridin-9-ylacetic acid?
2-acridin-9-ylacetic acid has a molecular weight of 237.26 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acridin-9-ylacetic acid is sourced from PubChem (CID 15525099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).