2-acridin-9-ylacetic acid

C15H11NO2 — CID 15525099

IUPAC2-acridin-9-ylacetic acid
SMILESO=C(O)Cc1c2ccccc2nc2ccccc12
InChIInChI=1S/C15H11NO2/c17-15(18)9-12-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8H,9H2,(H,17,18)
InChIKeyQTKFSQNJSBQUPW-UHFFFAOYSA-N
MW237.26 g/mol
LogP3.02
Rot. Bonds2

About 2-acridin-9-ylacetic acid

2-acridin-9-ylacetic acid (PubChem CID 15525099) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-acridin-9-ylacetic acid.

Molecular Properties

Compound Name2-acridin-9-ylacetic acid
PubChem CID15525099
Molecular FormulaC15H11NO2
Molecular Weight237.26 g/mol
Exact Mass237.08
IUPAC Name2-acridin-9-ylacetic acid
SMILESO=C(O)Cc1c2ccccc2nc2ccccc12
InChIInChI=1S/C15H11NO2/c17-15(18)9-12-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8H,9H2,(H,17,18)
InChIKeyQTKFSQNJSBQUPW-UHFFFAOYSA-N
XLogP3.02
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.26
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze 2-acridin-9-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acridin-9-ylacetic acid?
The IUPAC name of 2-acridin-9-ylacetic acid (CID 15525099) is 2-acridin-9-ylacetic acid.
What is the SMILES notation for 2-acridin-9-ylacetic acid?
The canonical SMILES for 2-acridin-9-ylacetic acid is O=C(O)Cc1c2ccccc2nc2ccccc12.
What is the InChIKey of 2-acridin-9-ylacetic acid?
The InChIKey is QTKFSQNJSBQUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2/c17-15(18)9-12-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8H,9H2,(H,17,18).
What are the key properties of 2-acridin-9-ylacetic acid?
2-acridin-9-ylacetic acid has a molecular weight of 237.26 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acridin-9-ylacetic acid is sourced from PubChem (CID 15525099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).