C22H21BrN2O5 — CID 155251084
1-[[3-[(5S)-5-(3-bromophenyl)-2-oxo-1,3-oxazolidin-3-yl]-4-methoxyphenyl]methyl]piperidine-2,6-dione (PubChem CID 155251084) has the molecular formula C22H21BrN2O5 and a molecular weight of 473.32 g/mol. Its IUPAC name is 1-[[3-[(5S)-5-(3-bromophenyl)-2-oxo-1,3-oxazolidin-3-yl]-4-methoxyphenyl]methyl]piperidine-2,6-dione.
| Compound Name | 1-[[3-[(5S)-5-(3-bromophenyl)-2-oxo-1,3-oxazolidin-3-yl]-4-methoxyphenyl]methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155251084 |
| Molecular Formula | C22H21BrN2O5 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 1-[[3-[(5S)-5-(3-bromophenyl)-2-oxo-1,3-oxazolidin-3-yl]-4-methoxyphenyl]methyl]piperidine-2,6-dione |
| SMILES | COc1ccc(CN2C(=O)CCCC2=O)cc1N1C[C@H](c2cccc(Br)c2)OC1=O |
| InChI | InChI=1S/C22H21BrN2O5/c1-29-18-9-8-14(12-25-20(26)6-3-7-21(25)27)10-17(18)24-13-19(30-22(24)28)15-4-2-5-16(23)11-15/h2,4-5,8-11,19H,3,6-7,12-13H2,1H3/t19-/m1/s1 |
| InChIKey | NXVADZFUZJZWHN-LJQANCHMSA-N |
| XLogP | 4.19 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|