C13H12N4 — CID 155251412
4-methyl-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 155251412) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 4-methyl-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-methyl-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 155251412 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-methyl-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1nc(N)nc2[nH]cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C13H12N4/c1-8-11-10(9-5-3-2-4-6-9)7-15-12(11)17-13(14)16-8/h2-7H,1H3,(H3,14,15,16,17) |
| InChIKey | PMBPRMOHEBPBJY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |