About 3-bromo-2-(trifluoromethyl)pyridine;thiophene
3-bromo-2-(trifluoromethyl)pyridine;thiophene (PubChem CID 155251528) has the molecular formula C10H7BrF3NS
and a molecular weight of 310.14 g/mol. Its IUPAC name is 3-bromo-2-(trifluoromethyl)pyridine;thiophene.
Molecular Properties
| Compound Name | 3-bromo-2-(trifluoromethyl)pyridine;thiophene |
| PubChem CID | 155251528 |
| Molecular Formula | C10H7BrF3NS |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 308.94 |
| IUPAC Name | 3-bromo-2-(trifluoromethyl)pyridine;thiophene |
| SMILES | FC(F)(F)c1ncccc1Br.c1ccsc1 |
| InChI | InChI=1S/C6H3BrF3N.C4H4S/c7-4-2-1-3-11-5(4)6(8,9)10;1-2-4-5-3-1/h1-3H;1-4H |
| InChIKey | OCGJCCGUKRTFBW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-2-(trifluoromethyl)pyridine;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(trifluoromethyl)pyridine;thiophene?
The IUPAC name of 3-bromo-2-(trifluoromethyl)pyridine;thiophene (CID 155251528) is 3-bromo-2-(trifluoromethyl)pyridine;thiophene.
What is the SMILES notation for 3-bromo-2-(trifluoromethyl)pyridine;thiophene?
The canonical SMILES for 3-bromo-2-(trifluoromethyl)pyridine;thiophene is FC(F)(F)c1ncccc1Br.c1ccsc1.
What is the InChIKey of 3-bromo-2-(trifluoromethyl)pyridine;thiophene?
The InChIKey is OCGJCCGUKRTFBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrF3N.C4H4S/c7-4-2-1-3-11-5(4)6(8,9)10;1-2-4-5-3-1/h1-3H;1-4H.
What are the key properties of 3-bromo-2-(trifluoromethyl)pyridine;thiophene?
3-bromo-2-(trifluoromethyl)pyridine;thiophene has a molecular weight of 310.14 g/mol, XLogP of 4.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(trifluoromethyl)pyridine;thiophene is sourced from PubChem (CID 155251528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).