C23H20F8N6O2 — CID 155252352
5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-4-fluoro-1-(2-fluoro-2-methylpropanoyl)pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide (PubChem CID 155252352) has the molecular formula C23H20F8N6O2 and a molecular weight of 564.44 g/mol. Its IUPAC name is 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-4-fluoro-1-(2-fluoro-2-methylpropanoyl)pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-4-fluoro-1-(2-fluoro-2-methylpropanoyl)pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155252352 |
| Molecular Formula | C23H20F8N6O2 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-4-fluoro-1-(2-fluoro-2-methylpropanoyl)pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(C)(F)C(=O)N1C[C@H](F)[C@H](NC(=O)c2cc(-c3cc(C(F)(F)F)c4c(N)ncnn34)ccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C23H20F8N6O2/c1-21(2,25)20(39)36-7-14(24)15(8-36)35-19(38)11-5-10(3-4-12(11)22(26,27)28)16-6-13(23(29,30)31)17-18(32)33-9-34-37(16)17/h3-6,9,14-15H,7-8H2,1-2H3,(H,35,38)(H2,32,33,34)/t14-,15+/m0/s1 |
| InChIKey | NHHQTVUKFIYKAU-LSDHHAIUSA-N |
| XLogP | 4.04 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |