C23H27F4N7O4S — CID 155252716
5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-4-fluoro-1-(3-methylbutan-2-ylsulfonyl)pyrrolidin-3-yl]-2-methoxypyridine-3-carboxamide (PubChem CID 155252716) has the molecular formula C23H27F4N7O4S and a molecular weight of 573.57 g/mol. Its IUPAC name is 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-4-fluoro-1-(3-methylbutan-2-ylsulfonyl)pyrrolidin-3-yl]-2-methoxypyridine-3-carboxamide.
| Compound Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-4-fluoro-1-(3-methylbutan-2-ylsulfonyl)pyrrolidin-3-yl]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 155252716 |
| Molecular Formula | C23H27F4N7O4S |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-4-fluoro-1-(3-methylbutan-2-ylsulfonyl)pyrrolidin-3-yl]-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncc(-c2cc(C(F)(F)F)c3c(N)ncnn23)cc1C(=O)N[C@@H]1CN(S(=O)(=O)C(C)C(C)C)C[C@@H]1F |
| InChI | InChI=1S/C23H27F4N7O4S/c1-11(2)12(3)39(36,37)33-8-16(24)17(9-33)32-21(35)14-5-13(7-29-22(14)38-4)18-6-15(23(25,26)27)19-20(28)30-10-31-34(18)19/h5-7,10-12,16-17H,8-9H2,1-4H3,(H,32,35)(H2,28,30,31)/t12?,16-,17+/m0/s1 |
| InChIKey | CLQGHAZGHFTGKK-CRRZLINXSA-N |
| XLogP | 2.53 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |