C23H17F7N6O2 — CID 155252847
5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluoro-N-(4,4,4-trifluoro-3-hydroxy-3-phenylbutyl)pyridine-3-carboxamide (PubChem CID 155252847) has the molecular formula C23H17F7N6O2 and a molecular weight of 542.42 g/mol. Its IUPAC name is 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluoro-N-(4,4,4-trifluoro-3-hydroxy-3-phenylbutyl)pyridine-3-carboxamide.
| Compound Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluoro-N-(4,4,4-trifluoro-3-hydroxy-3-phenylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155252847 |
| Molecular Formula | C23H17F7N6O2 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-fluoro-N-(4,4,4-trifluoro-3-hydroxy-3-phenylbutyl)pyridine-3-carboxamide |
| SMILES | Nc1ncnn2c(-c3cnc(F)c(C(=O)NCCC(O)(c4ccccc4)C(F)(F)F)c3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C23H17F7N6O2/c24-18-14(20(37)32-7-6-21(38,23(28,29)30)13-4-2-1-3-5-13)8-12(10-33-18)16-9-15(22(25,26)27)17-19(31)34-11-35-36(16)17/h1-5,8-11,38H,6-7H2,(H,32,37)(H2,31,34,35) |
| InChIKey | HAFHVDKUMUVOGI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|