About 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide
6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 155252984) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 155252984 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | CCC(C)C(=O)C1(C)C(C2CCNC2)=CC=CC1C(N)=O |
| InChI | InChI=1S/C17H26N2O2/c1-4-11(2)15(20)17(3)13(12-8-9-19-10-12)6-5-7-14(17)16(18)21/h5-7,11-12,14,19H,4,8-10H2,1-3H3,(H2,18,21) |
| InChIKey | YUEGQLYTXQBINM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide (CID 155252984) is 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide is CCC(C)C(=O)C1(C)C(C2CCNC2)=CC=CC1C(N)=O.
What is the InChIKey of 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide?
The InChIKey is YUEGQLYTXQBINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-4-11(2)15(20)17(3)13(12-8-9-19-10-12)6-5-7-14(17)16(18)21/h5-7,11-12,14,19H,4,8-10H2,1-3H3,(H2,18,21).
What are the key properties of 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide?
6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide has a molecular weight of 290.41 g/mol, XLogP of 1.82, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-6-(2-methylbutanoyl)-5-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 155252984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).