C9H8ClN2O4P — CID 155254162
[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylphosphonic acid (PubChem CID 155254162) has the molecular formula C9H8ClN2O4P and a molecular weight of 274.60 g/mol. Its IUPAC name is [5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylphosphonic acid.
| Compound Name | [5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 155254162 |
| Molecular Formula | C9H8ClN2O4P |
| Molecular Weight | 274.60 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | [5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1nnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C9H8ClN2O4P/c10-7-3-1-2-6(4-7)9-12-11-8(16-9)5-17(13,14)15/h1-4H,5H2,(H2,13,14,15) |
| InChIKey | PFXANVQXEFOASH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|