C26H22ClF2N3O3 — CID 155254358
(2R)-6-chloro-N-[(1R,2S,4R,5S)-5-[4-(3,4-difluorophenyl)imidazol-1-yl]-2-bicyclo[2.2.1]heptanyl]-4-oxo-2,3-dihydrochromene-2-carboxamide (PubChem CID 155254358) has the molecular formula C26H22ClF2N3O3 and a molecular weight of 497.93 g/mol. Its IUPAC name is (2R)-6-chloro-N-[(1R,2S,4R,5S)-5-[4-(3,4-difluorophenyl)imidazol-1-yl]-2-bicyclo[2.2.1]heptanyl]-4-oxo-2,3-dihydrochromene-2-carboxamide.
| Compound Name | (2R)-6-chloro-N-[(1R,2S,4R,5S)-5-[4-(3,4-difluorophenyl)imidazol-1-yl]-2-bicyclo[2.2.1]heptanyl]-4-oxo-2,3-dihydrochromene-2-carboxamide |
|---|---|
| PubChem CID | 155254358 |
| Molecular Formula | C26H22ClF2N3O3 |
| Molecular Weight | 497.93 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (2R)-6-chloro-N-[(1R,2S,4R,5S)-5-[4-(3,4-difluorophenyl)imidazol-1-yl]-2-bicyclo[2.2.1]heptanyl]-4-oxo-2,3-dihydrochromene-2-carboxamide |
| SMILES | O=C1C[C@H](C(=O)N[C@H]2C[C@H]3C[C@@H]2C[C@@H]3n2cnc(-c3ccc(F)c(F)c3)c2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H22ClF2N3O3/c27-16-2-4-24-17(9-16)23(33)10-25(35-24)26(34)31-20-7-15-5-14(20)8-22(15)32-11-21(30-12-32)13-1-3-18(28)19(29)6-13/h1-4,6,9,11-12,14-15,20,22,25H,5,7-8,10H2,(H,31,34)/t14-,15-,20+,22+,25-/m1/s1 |
| InChIKey | ZVWOGFDOMKNYDM-FWPMAKTASA-N |
| XLogP | 4.97 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |