C23H23ClF3N3O6 — CID 155254531
(2S,4S)-6-chloro-4-hydroxy-N-[5-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 155254531) has the molecular formula C23H23ClF3N3O6 and a molecular weight of 529.90 g/mol. Its IUPAC name is (2S,4S)-6-chloro-4-hydroxy-N-[5-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2S,4S)-6-chloro-4-hydroxy-N-[5-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 155254531 |
| Molecular Formula | C23H23ClF3N3O6 |
| Molecular Weight | 529.90 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (2S,4S)-6-chloro-4-hydroxy-N-[5-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | O=C(NC1CC2OC1CC2c1nnc(C2CC(OC(F)(F)F)C2)o1)[C@@H]1C[C@H](O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C23H23ClF3N3O6/c24-10-1-2-16-12(5-10)15(31)8-19(33-16)20(32)28-14-7-17-13(6-18(14)34-17)22-30-29-21(35-22)9-3-11(4-9)36-23(25,26)27/h1-2,5,9,11,13-15,17-19,31H,3-4,6-8H2,(H,28,32)/t9?,11?,13?,14?,15-,17?,18?,19-/m0/s1 |
| InChIKey | JOADWXJBZFREPA-UHEFOVAFSA-N |
| XLogP | 3.52 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.90 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |