About 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole
4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole (PubChem CID 155254688) has the molecular formula C16H13F3N2O3S
and a molecular weight of 370.35 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole |
| PubChem CID | 155254688 |
| Molecular Formula | C16H13F3N2O3S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1ccc(S(=O)(=O)C2N=COC2c2ccc(C(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C16H13F3N2O3S/c1-10-2-5-12(6-3-10)25(22,23)15-14(24-9-21-15)11-4-7-13(20-8-11)16(17,18)19/h2-9,14-15H,1H3 |
| InChIKey | HPILEJUFDJOSEP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole?
The IUPAC name of 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole (CID 155254688) is 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole is Cc1ccc(S(=O)(=O)C2N=COC2c2ccc(C(F)(F)F)nc2)cc1.
What is the InChIKey of 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole?
The InChIKey is HPILEJUFDJOSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N2O3S/c1-10-2-5-12(6-3-10)25(22,23)15-14(24-9-21-15)11-4-7-13(20-8-11)16(17,18)19/h2-9,14-15H,1H3.
What are the key properties of 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole?
4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole has a molecular weight of 370.35 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)sulfonyl-5-[6-(trifluoromethyl)-3-pyridinyl]-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 155254688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).