C27H29ClN2O6 — CID 155254771
(2R,4R)-6-chloro-N-[3-[5-[(3,5-dimethylphenoxy)methyl]-2-oxo-1,3-oxazolidin-3-yl]-1-bicyclo[1.1.1]pentanyl]-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 155254771) has the molecular formula C27H29ClN2O6 and a molecular weight of 512.99 g/mol. Its IUPAC name is (2R,4R)-6-chloro-N-[3-[5-[(3,5-dimethylphenoxy)methyl]-2-oxo-1,3-oxazolidin-3-yl]-1-bicyclo[1.1.1]pentanyl]-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2R,4R)-6-chloro-N-[3-[5-[(3,5-dimethylphenoxy)methyl]-2-oxo-1,3-oxazolidin-3-yl]-1-bicyclo[1.1.1]pentanyl]-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 155254771 |
| Molecular Formula | C27H29ClN2O6 |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | (2R,4R)-6-chloro-N-[3-[5-[(3,5-dimethylphenoxy)methyl]-2-oxo-1,3-oxazolidin-3-yl]-1-bicyclo[1.1.1]pentanyl]-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | Cc1cc(C)cc(OCC2CN(C34CC(NC(=O)[C@H]5C[C@@H](O)c6cc(Cl)ccc6O5)(C3)C4)C(=O)O2)c1 |
| InChI | InChI=1S/C27H29ClN2O6/c1-15-5-16(2)7-18(6-15)34-11-19-10-30(25(33)35-19)27-12-26(13-27,14-27)29-24(32)23-9-21(31)20-8-17(28)3-4-22(20)36-23/h3-8,19,21,23,31H,9-14H2,1-2H3,(H,29,32)/t19?,21-,23-,26?,27?/m1/s1 |
| InChIKey | RKMGUPDZBAWAPT-RFCNSKPYSA-N |
| XLogP | 3.83 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |