C28H29FN4 — CID 155254852
N-[2-[4-[[8-fluoro-7-(2-methylphenyl)-3H-pyrrolo[3,2-e]indazol-6-yl]methyl]phenyl]ethyl]propan-1-amine (PubChem CID 155254852) has the molecular formula C28H29FN4 and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[2-[4-[[8-fluoro-7-(2-methylphenyl)-3H-pyrrolo[3,2-e]indazol-6-yl]methyl]phenyl]ethyl]propan-1-amine.
| Compound Name | N-[2-[4-[[8-fluoro-7-(2-methylphenyl)-3H-pyrrolo[3,2-e]indazol-6-yl]methyl]phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 155254852 |
| Molecular Formula | C28H29FN4 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | N-[2-[4-[[8-fluoro-7-(2-methylphenyl)-3H-pyrrolo[3,2-e]indazol-6-yl]methyl]phenyl]ethyl]propan-1-amine |
| SMILES | CCCNCCc1ccc(Cn2c(-c3ccccc3C)c(F)c3c4cn[nH]c4ccc32)cc1 |
| InChI | InChI=1S/C28H29FN4/c1-3-15-30-16-14-20-8-10-21(11-9-20)18-33-25-13-12-24-23(17-31-32-24)26(25)27(29)28(33)22-7-5-4-6-19(22)2/h4-13,17,30H,3,14-16,18H2,1-2H3,(H,31,32) |
| InChIKey | SBUBVZUCMBJMLH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|