About methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate
methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate (PubChem CID 155255153) has the molecular formula C12H11Cl2NO4
and a molecular weight of 304.13 g/mol. Its IUPAC name is methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate |
| PubChem CID | 155255153 |
| Molecular Formula | C12H11Cl2NO4 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(OC(C)=O)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2NO4/c1-6(12(17)18-3)11(19-7(2)16)10-9(14)4-8(13)5-15-10/h4-5,11H,1H2,2-3H3 |
| InChIKey | JIGSECBCGBPUQC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate?
The IUPAC name of methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate (CID 155255153) is methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate.
What is the SMILES notation for methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate?
The canonical SMILES for methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate is C=C(C(=O)OC)C(OC(C)=O)c1ncc(Cl)cc1Cl.
What is the InChIKey of methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate?
The InChIKey is JIGSECBCGBPUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2NO4/c1-6(12(17)18-3)11(19-7(2)16)10-9(14)4-8(13)5-15-10/h4-5,11H,1H2,2-3H3.
What are the key properties of methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate?
methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate has a molecular weight of 304.13 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[acetyloxy-(3,5-dichloro-2-pyridinyl)methyl]prop-2-enoate is sourced from PubChem (CID 155255153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).