C15H19F3O6 — CID 155255402
4-O-spiro[3.3]heptan-2-yl 1-O-(3,3,3-trifluoro-2,2-dihydroxypropyl) 2-methylidenebutanedioate (PubChem CID 155255402) has the molecular formula C15H19F3O6 and a molecular weight of 352.31 g/mol. Its IUPAC name is 4-O-spiro[3.3]heptan-2-yl 1-O-(3,3,3-trifluoro-2,2-dihydroxypropyl) 2-methylidenebutanedioate.
| Compound Name | 4-O-spiro[3.3]heptan-2-yl 1-O-(3,3,3-trifluoro-2,2-dihydroxypropyl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 155255402 |
| Molecular Formula | C15H19F3O6 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-O-spiro[3.3]heptan-2-yl 1-O-(3,3,3-trifluoro-2,2-dihydroxypropyl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC1CC2(CCC2)C1)C(=O)OCC(O)(O)C(F)(F)F |
| InChI | InChI=1S/C15H19F3O6/c1-9(12(20)23-8-14(21,22)15(16,17)18)5-11(19)24-10-6-13(7-10)3-2-4-13/h10,21-22H,1-8H2 |
| InChIKey | YAPGXSRTRYQBLC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|