C19H23FN4O3 — CID 155255466
N-butyl-2-[4-(7-fluoro-1H-indole-2-carbonyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 155255466) has the molecular formula C19H23FN4O3 and a molecular weight of 374.42 g/mol. Its IUPAC name is N-butyl-2-[4-(7-fluoro-1H-indole-2-carbonyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-butyl-2-[4-(7-fluoro-1H-indole-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 155255466 |
| Molecular Formula | C19H23FN4O3 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-butyl-2-[4-(7-fluoro-1H-indole-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | CCCCNC(=O)C(=O)N1CCN(C(=O)c2cc3cccc(F)c3[nH]2)CC1 |
| InChI | InChI=1S/C19H23FN4O3/c1-2-3-7-21-17(25)19(27)24-10-8-23(9-11-24)18(26)15-12-13-5-4-6-14(20)16(13)22-15/h4-6,12,22H,2-3,7-11H2,1H3,(H,21,25) |
| InChIKey | FSTJFVXLKXLBII-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|