About 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate
4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate (PubChem CID 155255762) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate.
Molecular Properties
| Compound Name | 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate |
| PubChem CID | 155255762 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC1(C2CCCCC2)CC1)C(=O)OC |
| InChI | InChI=1S/C15H22O4/c1-11(14(17)18-2)10-13(16)19-15(8-9-15)12-6-4-3-5-7-12/h12H,1,3-10H2,2H3 |
| InChIKey | DYNYTLCECRKZCH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate?
The IUPAC name of 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate (CID 155255762) is 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate.
What is the SMILES notation for 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate?
The canonical SMILES for 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate is C=C(CC(=O)OC1(C2CCCCC2)CC1)C(=O)OC.
What is the InChIKey of 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate?
The InChIKey is DYNYTLCECRKZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-11(14(17)18-2)10-13(16)19-15(8-9-15)12-6-4-3-5-7-12/h12H,1,3-10H2,2H3.
What are the key properties of 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate?
4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate has a molecular weight of 266.34 g/mol, XLogP of 2.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(1-cyclohexylcyclopropyl) 1-O-methyl 2-methylidenebutanedioate is sourced from PubChem (CID 155255762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).