C17H25F3O6 — CID 155256012
(3S)-4,4,4-trifluoro-3-[2-methylidene-4-[(2R)-octan-2-yl]oxy-4-oxobutanoyl]oxybutanoic acid (PubChem CID 155256012) has the molecular formula C17H25F3O6 and a molecular weight of 382.38 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-[2-methylidene-4-[(2R)-octan-2-yl]oxy-4-oxobutanoyl]oxybutanoic acid.
| Compound Name | (3S)-4,4,4-trifluoro-3-[2-methylidene-4-[(2R)-octan-2-yl]oxy-4-oxobutanoyl]oxybutanoic acid |
|---|---|
| PubChem CID | 155256012 |
| Molecular Formula | C17H25F3O6 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-[2-methylidene-4-[(2R)-octan-2-yl]oxy-4-oxobutanoyl]oxybutanoic acid |
| SMILES | C=C(CC(=O)O[C@H](C)CCCCCC)C(=O)O[C@@H](CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C17H25F3O6/c1-4-5-6-7-8-12(3)25-15(23)9-11(2)16(24)26-13(10-14(21)22)17(18,19)20/h12-13H,2,4-10H2,1,3H3,(H,21,22)/t12-,13+/m1/s1 |
| InChIKey | UISDIAYVZQVGNB-OLZOCXBDSA-N |
| XLogP | 3.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|