C11H15NO4 — CID 15525620
2-(1-methoxycarbonyl-4H-pyridin-4-yl)-2-methylpropanoic acid (PubChem CID 15525620) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(1-methoxycarbonyl-4H-pyridin-4-yl)-2-methylpropanoic acid.
| Compound Name | 2-(1-methoxycarbonyl-4H-pyridin-4-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 15525620 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(1-methoxycarbonyl-4H-pyridin-4-yl)-2-methylpropanoic acid |
| SMILES | COC(=O)N1C=CC(C(C)(C)C(=O)O)C=C1 |
| InChI | InChI=1S/C11H15NO4/c1-11(2,9(13)14)8-4-6-12(7-5-8)10(15)16-3/h4-8H,1-3H3,(H,13,14) |
| InChIKey | HSKZAIQWRNEWJA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |